methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate

C14H16N2O2S — CID 107039874

IUPACmethyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate
SMILESCOC(=O)CCc1csc(NCc2ccccc2)n1
InChIInChI=1S/C14H16N2O2S/c1-18-13(17)8-7-12-10-19-14(16-12)15-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,16)
InChIKeyWREDTXAPFWUKED-UHFFFAOYSA-N
MW276.36 g/mol
LogP2.86
Rot. Bonds6

About methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate

methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate (PubChem CID 107039874) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate.

Molecular Properties

Compound Namemethyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate
PubChem CID107039874
Molecular FormulaC14H16N2O2S
Molecular Weight276.36 g/mol
Exact Mass276.09
IUPAC Namemethyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate
SMILESCOC(=O)CCc1csc(NCc2ccccc2)n1
InChIInChI=1S/C14H16N2O2S/c1-18-13(17)8-7-12-10-19-14(16-12)15-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,16)
InChIKeyWREDTXAPFWUKED-UHFFFAOYSA-N
XLogP2.86
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.36
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate?
The IUPAC name of methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate (CID 107039874) is methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate.
What is the SMILES notation for methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate?
The canonical SMILES for methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate is COC(=O)CCc1csc(NCc2ccccc2)n1.
What is the InChIKey of methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate?
The InChIKey is WREDTXAPFWUKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c1-18-13(17)8-7-12-10-19-14(16-12)15-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,16).
What are the key properties of methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate?
methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate has a molecular weight of 276.36 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(benzylamino)-1,3-thiazol-4-yl]propanoate is sourced from PubChem (CID 107039874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).