C24H35N5O5S — CID 87759437
[[4-[2-(2-acetamido-1,3-thiazol-5-yl)ethyl]anilino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid (PubChem CID 87759437) has the molecular formula C24H35N5O5S and a molecular weight of 505.64 g/mol. Its IUPAC name is [[4-[2-(2-acetamido-1,3-thiazol-5-yl)ethyl]anilino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid.
| Compound Name | [[4-[2-(2-acetamido-1,3-thiazol-5-yl)ethyl]anilino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87759437 |
| Molecular Formula | C24H35N5O5S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [[4-[2-(2-acetamido-1,3-thiazol-5-yl)ethyl]anilino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid |
| SMILES | CC(=O)Nc1ncc(CCc2ccc(NC(N(C(=O)O)C(C)(C)C)N(C(=O)O)C(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C24H35N5O5S/c1-15(30)26-19-25-14-18(35-19)13-10-16-8-11-17(12-9-16)27-20(28(21(31)32)23(2,3)4)29(22(33)34)24(5,6)7/h8-9,11-12,14,20,27H,10,13H2,1-7H3,(H,31,32)(H,33,34)(H,25,26,30) |
| InChIKey | ONDUTZFQIWIJHP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|