C31H42N6O4 — CID 143501891
6-[[(Z,5Z)-5-(aminomethylimino)-3-methylhex-3-enyl]amino]-1,3-bis[(4-ethoxy-3-methylphenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 143501891) has the molecular formula C31H42N6O4 and a molecular weight of 562.72 g/mol. Its IUPAC name is 6-[[(Z,5Z)-5-(aminomethylimino)-3-methylhex-3-enyl]amino]-1,3-bis[(4-ethoxy-3-methylphenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[[(Z,5Z)-5-(aminomethylimino)-3-methylhex-3-enyl]amino]-1,3-bis[(4-ethoxy-3-methylphenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 143501891 |
| Molecular Formula | C31H42N6O4 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 6-[[(Z,5Z)-5-(aminomethylimino)-3-methylhex-3-enyl]amino]-1,3-bis[(4-ethoxy-3-methylphenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | CCOc1ccc(Cn2c(NCC/C(C)=C\C(C)=N/CN)nc(=O)n(Cc3ccc(OCC)c(C)c3)c2=O)cc1C |
| InChI | InChI=1S/C31H42N6O4/c1-7-40-27-11-9-25(16-22(27)4)18-36-29(33-14-13-21(3)15-24(6)34-20-32)35-30(38)37(31(36)39)19-26-10-12-28(41-8-2)23(5)17-26/h9-12,15-17H,7-8,13-14,18-20,32H2,1-6H3,(H,33,35,38)/b21-15-,34-24- |
| InChIKey | QKJVITIYCUZORR-FJZHLKGLSA-N |
| XLogP | 4.04 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|