C29H25F4N7O4 — CID 42605737
2,2,2-trifluoro-N-[1-[2-[[5-[(4-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]benzimidazol-2-yl]acetamide (PubChem CID 42605737) has the molecular formula C29H25F4N7O4 and a molecular weight of 611.56 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-[2-[[5-[(4-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]benzimidazol-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-[2-[[5-[(4-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]benzimidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 42605737 |
| Molecular Formula | C29H25F4N7O4 |
| Molecular Weight | 611.56 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-[2-[[5-[(4-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]benzimidazol-2-yl]acetamide |
| SMILES | COc1ccc(Cn2c(NCCn3c(NC(=O)C(F)(F)F)nc4ccccc43)nc(=O)n(Cc3ccc(F)cc3)c2=O)cc1 |
| InChI | InChI=1S/C29H25F4N7O4/c1-44-21-12-8-19(9-13-21)16-39-25(37-27(42)40(28(39)43)17-18-6-10-20(30)11-7-18)34-14-15-38-23-5-3-2-4-22(23)35-26(38)36-24(41)29(31,32)33/h2-13H,14-17H2,1H3,(H,34,37,42)(H,35,36,41) |
| InChIKey | XXNVZRNVNZKIJP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |