C24H19FN2O2 — CID 175670562
(E)-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 175670562) has the molecular formula C24H19FN2O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is (E)-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175670562 |
| Molecular Formula | C24H19FN2O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (E)-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2nc3ccccc3n2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H19FN2O2/c1-29-20-13-8-17(9-14-20)10-15-23(28)24-26-21-4-2-3-5-22(21)27(24)16-18-6-11-19(25)12-7-18/h2-15H,16H2,1H3/b15-10+ |
| InChIKey | QJRDROVJKOQIFD-XNTDXEJSSA-N |
| XLogP | 5.13 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|