C21H27N7O3 — CID 123544580
2-[2-[[1-[(4-hydroxyphenyl)methyl]-5-[(4-methoxyphenyl)methyl]-6-oxo-2H-1,3,5-triazin-4-yl]amino]ethyl]guanidine (PubChem CID 123544580) has the molecular formula C21H27N7O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[2-[[1-[(4-hydroxyphenyl)methyl]-5-[(4-methoxyphenyl)methyl]-6-oxo-2H-1,3,5-triazin-4-yl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[1-[(4-hydroxyphenyl)methyl]-5-[(4-methoxyphenyl)methyl]-6-oxo-2H-1,3,5-triazin-4-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 123544580 |
| Molecular Formula | C21H27N7O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[2-[[1-[(4-hydroxyphenyl)methyl]-5-[(4-methoxyphenyl)methyl]-6-oxo-2H-1,3,5-triazin-4-yl]amino]ethyl]guanidine |
| SMILES | COc1ccc(CN2C(=O)N(Cc3ccc(O)cc3)CN=C2NCCN=C(N)N)cc1 |
| InChI | InChI=1S/C21H27N7O3/c1-31-18-8-4-16(5-9-18)13-28-20(25-11-10-24-19(22)23)26-14-27(21(28)30)12-15-2-6-17(29)7-3-15/h2-9,29H,10-14H2,1H3,(H,25,26)(H4,22,23,24) |
| InChIKey | KORTVLNNFQEJCZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|