C16H13ClN4O2 — CID 170005837
6-chloro-1,3-bis(pyridin-3-ylmethyl)pyrimidine-2,4-dione (PubChem CID 170005837) has the molecular formula C16H13ClN4O2 and a molecular weight of 328.76 g/mol. Its IUPAC name is 6-chloro-1,3-bis(pyridin-3-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 6-chloro-1,3-bis(pyridin-3-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170005837 |
| Molecular Formula | C16H13ClN4O2 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 6-chloro-1,3-bis(pyridin-3-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1cc(Cl)n(Cc2cccnc2)c(=O)n1Cc1cccnc1 |
| InChI | InChI=1S/C16H13ClN4O2/c17-14-7-15(22)21(11-13-4-2-6-19-9-13)16(23)20(14)10-12-3-1-5-18-8-12/h1-9H,10-11H2 |
| InChIKey | JGPMDYWCGYUEQX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |