C22H26N4O5 — CID 10526453
10-ethyl-1,3-dimethoxy-6-(4-methylpiperazin-1-yl)-7-nitroacridin-9-one (PubChem CID 10526453) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 10-ethyl-1,3-dimethoxy-6-(4-methylpiperazin-1-yl)-7-nitroacridin-9-one.
| Compound Name | 10-ethyl-1,3-dimethoxy-6-(4-methylpiperazin-1-yl)-7-nitroacridin-9-one |
|---|---|
| PubChem CID | 10526453 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 10-ethyl-1,3-dimethoxy-6-(4-methylpiperazin-1-yl)-7-nitroacridin-9-one |
| SMILES | CCn1c2cc(N3CCN(C)CC3)c([N+](=O)[O-])cc2c(=O)c2c(OC)cc(OC)cc21 |
| InChI | InChI=1S/C22H26N4O5/c1-5-25-16-13-17(24-8-6-23(2)7-9-24)18(26(28)29)12-15(16)22(27)21-19(25)10-14(30-3)11-20(21)31-4/h10-13H,5-9H2,1-4H3 |
| InChIKey | MFIUMNAXUDMXST-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|