C15H21N5O5S — CID 3721186
5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dimethyl-6-nitrobenzimidazol-2-one (PubChem CID 3721186) has the molecular formula C15H21N5O5S and a molecular weight of 383.43 g/mol. Its IUPAC name is 5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dimethyl-6-nitrobenzimidazol-2-one.
| Compound Name | 5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dimethyl-6-nitrobenzimidazol-2-one |
|---|---|
| PubChem CID | 3721186 |
| Molecular Formula | C15H21N5O5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dimethyl-6-nitrobenzimidazol-2-one |
| SMILES | CCS(=O)(=O)N1CCN(c2cc3c(cc2[N+](=O)[O-])n(C)c(=O)n3C)CC1 |
| InChI | InChI=1S/C15H21N5O5S/c1-4-26(24,25)19-7-5-18(6-8-19)13-9-11-12(10-14(13)20(22)23)17(3)15(21)16(11)2/h9-10H,4-8H2,1-3H3 |
| InChIKey | PRMLGLGCHNACHP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 110.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|