C21H22N4O5S — CID 123241361
1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]-3H-isoquinolin-4-one (PubChem CID 123241361) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]-3H-isoquinolin-4-one.
| Compound Name | 1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]-3H-isoquinolin-4-one |
|---|---|
| PubChem CID | 123241361 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]-3H-isoquinolin-4-one |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc(C3=NCC(=O)c4ccccc43)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H22N4O5S/c1-2-31(29,30)24-11-9-23(10-12-24)18-8-7-15(13-19(18)25(27)28)21-17-6-4-3-5-16(17)20(26)14-22-21/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | KFBHMRSCRPNYFO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|