C24H32N4O5S — CID 143209201
ethene;2-[1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]ethyl]-N-methylbenzamide (PubChem CID 143209201) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is ethene;2-[1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]ethyl]-N-methylbenzamide.
| Compound Name | ethene;2-[1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 143209201 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | ethene;2-[1-[4-(4-ethylsulfonylpiperazin-1-yl)-3-nitrophenyl]ethyl]-N-methylbenzamide |
| SMILES | C=C.CCS(=O)(=O)N1CCN(c2ccc(C(C)c3ccccc3C(=O)NC)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H28N4O5S.C2H4/c1-4-32(30,31)25-13-11-24(12-14-25)20-10-9-17(15-21(20)26(28)29)16(2)18-7-5-6-8-19(18)22(27)23-3;1-2/h5-10,15-16H,4,11-14H2,1-3H3,(H,23,27);1-2H2 |
| InChIKey | NRCXYBAQXPEHTG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|