C20H21N3O3S — CID 143806162
N-methyl-2-[1-(3-nitro-4-thiomorpholin-4-ylphenyl)ethenyl]benzamide (PubChem CID 143806162) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-methyl-2-[1-(3-nitro-4-thiomorpholin-4-ylphenyl)ethenyl]benzamide.
| Compound Name | N-methyl-2-[1-(3-nitro-4-thiomorpholin-4-ylphenyl)ethenyl]benzamide |
|---|---|
| PubChem CID | 143806162 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-methyl-2-[1-(3-nitro-4-thiomorpholin-4-ylphenyl)ethenyl]benzamide |
| SMILES | C=C(c1ccc(N2CCSCC2)c([N+](=O)[O-])c1)c1ccccc1C(=O)NC |
| InChI | InChI=1S/C20H21N3O3S/c1-14(16-5-3-4-6-17(16)20(24)21-2)15-7-8-18(19(13-15)23(25)26)22-9-11-27-12-10-22/h3-8,13H,1,9-12H2,2H3,(H,21,24) |
| InChIKey | GWKNHTWFIOMOFL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|