C23H26F3N3O3S — CID 143806168
2-[1-[4-(azepan-1-yl)-3-(trifluoromethylsulfonylamino)phenyl]ethenyl]-N-methylbenzamide (PubChem CID 143806168) has the molecular formula C23H26F3N3O3S and a molecular weight of 481.54 g/mol. Its IUPAC name is 2-[1-[4-(azepan-1-yl)-3-(trifluoromethylsulfonylamino)phenyl]ethenyl]-N-methylbenzamide.
| Compound Name | 2-[1-[4-(azepan-1-yl)-3-(trifluoromethylsulfonylamino)phenyl]ethenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 143806168 |
| Molecular Formula | C23H26F3N3O3S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[1-[4-(azepan-1-yl)-3-(trifluoromethylsulfonylamino)phenyl]ethenyl]-N-methylbenzamide |
| SMILES | C=C(c1ccc(N2CCCCCC2)c(NS(=O)(=O)C(F)(F)F)c1)c1ccccc1C(=O)NC |
| InChI | InChI=1S/C23H26F3N3O3S/c1-16(18-9-5-6-10-19(18)22(30)27-2)17-11-12-21(29-13-7-3-4-8-14-29)20(15-17)28-33(31,32)23(24,25)26/h5-6,9-12,15,28H,1,3-4,7-8,13-14H2,2H3,(H,27,30) |
| InChIKey | FXFLXRCQAJAODN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|