C22H27FN4O4S — CID 2885410
1-(4-fluoro-2-nitro-5-piperidin-1-ylphenyl)-4-(4-methylphenyl)sulfonylpiperazine (PubChem CID 2885410) has the molecular formula C22H27FN4O4S and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-(4-fluoro-2-nitro-5-piperidin-1-ylphenyl)-4-(4-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-(4-fluoro-2-nitro-5-piperidin-1-ylphenyl)-4-(4-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 2885410 |
| Molecular Formula | C22H27FN4O4S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1-(4-fluoro-2-nitro-5-piperidin-1-ylphenyl)-4-(4-methylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3cc(N4CCCCC4)c(F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H27FN4O4S/c1-17-5-7-18(8-6-17)32(30,31)26-13-11-25(12-14-26)21-16-20(24-9-3-2-4-10-24)19(23)15-22(21)27(28)29/h5-8,15-16H,2-4,9-14H2,1H3 |
| InChIKey | KGGPRJBBUKHKCL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|