C23H30N4O5 — CID 10575195
10-[2-(diethylamino)ethyl]-6-(dimethylamino)-1,3-dimethoxy-7-nitroacridin-9-one (PubChem CID 10575195) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 10-[2-(diethylamino)ethyl]-6-(dimethylamino)-1,3-dimethoxy-7-nitroacridin-9-one.
| Compound Name | 10-[2-(diethylamino)ethyl]-6-(dimethylamino)-1,3-dimethoxy-7-nitroacridin-9-one |
|---|---|
| PubChem CID | 10575195 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 10-[2-(diethylamino)ethyl]-6-(dimethylamino)-1,3-dimethoxy-7-nitroacridin-9-one |
| SMILES | CCN(CC)CCn1c2cc(N(C)C)c([N+](=O)[O-])cc2c(=O)c2c(OC)cc(OC)cc21 |
| InChI | InChI=1S/C23H30N4O5/c1-7-25(8-2)9-10-26-17-14-18(24(3)4)19(27(29)30)13-16(17)23(28)22-20(26)11-15(31-5)12-21(22)32-6/h11-14H,7-10H2,1-6H3 |
| InChIKey | ADCCOKJBFVJCOV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|