C36H30N4O10 — CID 102410419
1-[2-[1-acetyl-4,6-dimethoxy-3-(4-nitrophenyl)indol-2-yl]-4,6-dimethoxy-3-(4-nitrophenyl)indol-1-yl]ethanone (PubChem CID 102410419) has the molecular formula C36H30N4O10 and a molecular weight of 678.65 g/mol. Its IUPAC name is 1-[2-[1-acetyl-4,6-dimethoxy-3-(4-nitrophenyl)indol-2-yl]-4,6-dimethoxy-3-(4-nitrophenyl)indol-1-yl]ethanone.
| Compound Name | 1-[2-[1-acetyl-4,6-dimethoxy-3-(4-nitrophenyl)indol-2-yl]-4,6-dimethoxy-3-(4-nitrophenyl)indol-1-yl]ethanone |
|---|---|
| PubChem CID | 102410419 |
| Molecular Formula | C36H30N4O10 |
| Molecular Weight | 678.65 g/mol |
| Exact Mass | 678.20 |
| IUPAC Name | 1-[2-[1-acetyl-4,6-dimethoxy-3-(4-nitrophenyl)indol-2-yl]-4,6-dimethoxy-3-(4-nitrophenyl)indol-1-yl]ethanone |
| SMILES | COc1cc(OC)c2c(-c3ccc([N+](=O)[O-])cc3)c(-c3c(-c4ccc([N+](=O)[O-])cc4)c4c(OC)cc(OC)cc4n3C(C)=O)n(C(C)=O)c2c1 |
| InChI | InChI=1S/C36H30N4O10/c1-19(41)37-27-15-25(47-3)17-29(49-5)33(27)31(21-7-11-23(12-8-21)39(43)44)35(37)36-32(22-9-13-24(14-10-22)40(45)46)34-28(38(36)20(2)42)16-26(48-4)18-30(34)50-6/h7-18H,1-6H3 |
| InChIKey | RCXNWLQRTKPHAD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 167.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.65 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|