C30H26N2O5 — CID 11752278
[6,8-dimethoxy-1-(4-phenylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone (PubChem CID 11752278) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is [6,8-dimethoxy-1-(4-phenylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone.
| Compound Name | [6,8-dimethoxy-1-(4-phenylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 11752278 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [6,8-dimethoxy-1-(4-phenylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone |
| SMILES | COc1cc2c(c(OC)c1)C(c1ccc(-c3ccccc3)cc1)N(C(=O)c1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C30H26N2O5/c1-36-26-18-24-16-17-31(30(33)23-12-14-25(15-13-23)32(34)35)29(28(24)27(19-26)37-2)22-10-8-21(9-11-22)20-6-4-3-5-7-20/h3-15,18-19,29H,16-17H2,1-2H3 |
| InChIKey | VHXIWFCJEIZJBG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|