C20H19N3O3 — CID 4911333
5-ethyl-8-methoxy-3-(4-methoxyphenyl)pyridazino[4,5-b]indol-4-one (PubChem CID 4911333) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 5-ethyl-8-methoxy-3-(4-methoxyphenyl)pyridazino[4,5-b]indol-4-one.
| Compound Name | 5-ethyl-8-methoxy-3-(4-methoxyphenyl)pyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 4911333 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 5-ethyl-8-methoxy-3-(4-methoxyphenyl)pyridazino[4,5-b]indol-4-one |
| SMILES | CCn1c2ccc(OC)cc2c2cnn(-c3ccc(OC)cc3)c(=O)c21 |
| InChI | InChI=1S/C20H19N3O3/c1-4-22-18-10-9-15(26-3)11-16(18)17-12-21-23(20(24)19(17)22)13-5-7-14(25-2)8-6-13/h5-12H,4H2,1-3H3 |
| InChIKey | KLRPINRNCOQQOI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |