C19H17N3O2 — CID 4903253
3-(4-methoxyphenyl)-5,7-dimethylpyridazino[4,5-b]indol-4-one (PubChem CID 4903253) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5,7-dimethylpyridazino[4,5-b]indol-4-one.
| Compound Name | 3-(4-methoxyphenyl)-5,7-dimethylpyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 4903253 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-5,7-dimethylpyridazino[4,5-b]indol-4-one |
| SMILES | COc1ccc(-n2ncc3c4ccc(C)cc4n(C)c3c2=O)cc1 |
| InChI | InChI=1S/C19H17N3O2/c1-12-4-9-15-16-11-20-22(13-5-7-14(24-3)8-6-13)19(23)18(16)21(2)17(15)10-12/h4-11H,1-3H3 |
| InChIKey | NKPHHJPMFHZQBN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |