C24H28N4O4 — CID 22150166
N-[1-[2-(6,7-dimethoxy-1-oxophthalazin-2-yl)ethyl]piperidin-4-yl]benzamide (PubChem CID 22150166) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[1-[2-(6,7-dimethoxy-1-oxophthalazin-2-yl)ethyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[2-(6,7-dimethoxy-1-oxophthalazin-2-yl)ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 22150166 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[1-[2-(6,7-dimethoxy-1-oxophthalazin-2-yl)ethyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc2cnn(CCN3CCC(NC(=O)c4ccccc4)CC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C24H28N4O4/c1-31-21-14-18-16-25-28(24(30)20(18)15-22(21)32-2)13-12-27-10-8-19(9-11-27)26-23(29)17-6-4-3-5-7-17/h3-7,14-16,19H,8-13H2,1-2H3,(H,26,29) |
| InChIKey | NLRVEKYWIJCICT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |