About 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one
2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one (PubChem CID 13327031) has the molecular formula C13H15BrN2O3
and a molecular weight of 327.18 g/mol. Its IUPAC name is 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one.
Molecular Properties
| Compound Name | 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one |
| PubChem CID | 13327031 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one |
| SMILES | COc1cc2c(C)nn(CCBr)c(=O)c2cc1OC |
| InChI | InChI=1S/C13H15BrN2O3/c1-8-9-6-11(18-2)12(19-3)7-10(9)13(17)16(15-8)5-4-14/h6-7H,4-5H2,1-3H3 |
| InChIKey | YFEWNWCVZDPGOS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one?
The IUPAC name of 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one (CID 13327031) is 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one.
What is the SMILES notation for 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one?
The canonical SMILES for 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one is COc1cc2c(C)nn(CCBr)c(=O)c2cc1OC.
What is the InChIKey of 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one?
The InChIKey is YFEWNWCVZDPGOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O3/c1-8-9-6-11(18-2)12(19-3)7-10(9)13(17)16(15-8)5-4-14/h6-7H,4-5H2,1-3H3.
What are the key properties of 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one?
2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one has a molecular weight of 327.18 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromoethyl)-6,7-dimethoxy-4-methylphthalazin-1-one is sourced from PubChem (CID 13327031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).