C16H12N4O6-2 — CID 6969277
2-[2-(carboxylatomethyl)-4,9-dimethyl-1,6-dioxopyridazino[4,5-g]phthalazin-7-yl]acetate (PubChem CID 6969277) has the molecular formula C16H12N4O6-2 and a molecular weight of 356.29 g/mol. Its IUPAC name is 2-[2-(carboxylatomethyl)-4,9-dimethyl-1,6-dioxopyridazino[4,5-g]phthalazin-7-yl]acetate.
| Compound Name | 2-[2-(carboxylatomethyl)-4,9-dimethyl-1,6-dioxopyridazino[4,5-g]phthalazin-7-yl]acetate |
|---|---|
| PubChem CID | 6969277 |
| Molecular Formula | C16H12N4O6-2 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[2-(carboxylatomethyl)-4,9-dimethyl-1,6-dioxopyridazino[4,5-g]phthalazin-7-yl]acetate |
| SMILES | Cc1nn(CC(=O)[O-])c(=O)c2cc3c(C)nn(CC(=O)[O-])c(=O)c3cc12 |
| InChI | InChI=1S/C16H14N4O6/c1-7-9-3-12-10(8(2)18-20(16(12)26)6-14(23)24)4-11(9)15(25)19(17-7)5-13(21)22/h3-4H,5-6H2,1-2H3,(H,21,22)(H,23,24)/p-2 |
| InChIKey | ZQYBPNRCEYDVOR-UHFFFAOYSA-L |
| XLogP | -2.78 |
| TPSA | 150.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|