C13H14BrNO4 — CID 12518802
2-(3-bromopropyl)-5,6-dimethoxyisoindole-1,3-dione (PubChem CID 12518802) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 2-(3-bromopropyl)-5,6-dimethoxyisoindole-1,3-dione.
| Compound Name | 2-(3-bromopropyl)-5,6-dimethoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 12518802 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-(3-bromopropyl)-5,6-dimethoxyisoindole-1,3-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)N(CCCBr)C2=O |
| InChI | InChI=1S/C13H14BrNO4/c1-18-10-6-8-9(7-11(10)19-2)13(17)15(12(8)16)5-3-4-14/h6-7H,3-5H2,1-2H3 |
| InChIKey | IQZPIXRDPRRVNR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|