C14H17BrN2O3 — CID 10854688
2-(4-bromobutyl)-4-ethoxy-6-methylpyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 10854688) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is 2-(4-bromobutyl)-4-ethoxy-6-methylpyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-(4-bromobutyl)-4-ethoxy-6-methylpyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 10854688 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-(4-bromobutyl)-4-ethoxy-6-methylpyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | CCOc1nc(C)cc2c1C(=O)N(CCCCBr)C2=O |
| InChI | InChI=1S/C14H17BrN2O3/c1-3-20-12-11-10(8-9(2)16-12)13(18)17(14(11)19)7-5-4-6-15/h8H,3-7H2,1-2H3 |
| InChIKey | VUJPYOKMAPKXRH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|