C12H12ClNO3 — CID 14634670
2-chloro-1-(5,6-dimethoxyindol-1-yl)ethanone (PubChem CID 14634670) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-chloro-1-(5,6-dimethoxyindol-1-yl)ethanone.
| Compound Name | 2-chloro-1-(5,6-dimethoxyindol-1-yl)ethanone |
|---|---|
| PubChem CID | 14634670 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-chloro-1-(5,6-dimethoxyindol-1-yl)ethanone |
| SMILES | COc1cc2ccn(C(=O)CCl)c2cc1OC |
| InChI | InChI=1S/C12H12ClNO3/c1-16-10-5-8-3-4-14(12(15)7-13)9(8)6-11(10)17-2/h3-6H,7H2,1-2H3 |
| InChIKey | ODDCOGXBTLPSBR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|