C13H14N2O2 — CID 21216857
3-(5,6-dimethoxyindol-1-yl)propanenitrile (PubChem CID 21216857) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 3-(5,6-dimethoxyindol-1-yl)propanenitrile.
| Compound Name | 3-(5,6-dimethoxyindol-1-yl)propanenitrile |
|---|---|
| PubChem CID | 21216857 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-(5,6-dimethoxyindol-1-yl)propanenitrile |
| SMILES | COc1cc2ccn(CCC#N)c2cc1OC |
| InChI | InChI=1S/C13H14N2O2/c1-16-12-8-10-4-7-15(6-3-5-14)11(10)9-13(12)17-2/h4,7-9H,3,6H2,1-2H3 |
| InChIKey | SRNAFIHMXUKOTP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |