C15H21NO3 — CID 83944745
3-(5,6-diethoxyindol-1-yl)propan-1-ol (PubChem CID 83944745) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-(5,6-diethoxyindol-1-yl)propan-1-ol.
| Compound Name | 3-(5,6-diethoxyindol-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 83944745 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-(5,6-diethoxyindol-1-yl)propan-1-ol |
| SMILES | CCOc1cc2ccn(CCCO)c2cc1OCC |
| InChI | InChI=1S/C15H21NO3/c1-3-18-14-10-12-6-8-16(7-5-9-17)13(12)11-15(14)19-4-2/h6,8,10-11,17H,3-5,7,9H2,1-2H3 |
| InChIKey | IFAZAEJBHCFRSP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |