C18H16ClNO3 — CID 138857576
2-chloro-1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone (PubChem CID 138857576) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is 2-chloro-1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone.
| Compound Name | 2-chloro-1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone |
|---|---|
| PubChem CID | 138857576 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-chloro-1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone |
| SMILES | COc1cc2cc(C(=O)CCl)n(-c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C18H16ClNO3/c1-22-17-9-12-8-15(16(21)11-19)20(13-6-4-3-5-7-13)14(12)10-18(17)23-2/h3-10H,11H2,1-2H3 |
| InChIKey | NLRGXAGJZFOIHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|