C18H17NO3 — CID 138857566
1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone (PubChem CID 138857566) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone.
| Compound Name | 1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone |
|---|---|
| PubChem CID | 138857566 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-(5,6-dimethoxy-1-phenylindol-2-yl)ethanone |
| SMILES | COc1cc2cc(C(C)=O)n(-c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C18H17NO3/c1-12(20)15-9-13-10-17(21-2)18(22-3)11-16(13)19(15)14-7-5-4-6-8-14/h4-11H,1-3H3 |
| InChIKey | AUNWOVYHEWEJAD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |