C28H27N3O10 — CID 19775219
4-phenyl-1,2-bis(3,4,5-trimethoxybenzoyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 19775219) has the molecular formula C28H27N3O10 and a molecular weight of 565.54 g/mol. Its IUPAC name is 4-phenyl-1,2-bis(3,4,5-trimethoxybenzoyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-phenyl-1,2-bis(3,4,5-trimethoxybenzoyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 19775219 |
| Molecular Formula | C28H27N3O10 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 4-phenyl-1,2-bis(3,4,5-trimethoxybenzoyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | COc1cc(C(=O)n2c(=O)n(-c3ccccc3)c(=O)n2C(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H27N3O10/c1-36-19-12-16(13-20(37-2)23(19)40-5)25(32)30-27(34)29(18-10-8-7-9-11-18)28(35)31(30)26(33)17-14-21(38-3)24(41-6)22(15-17)39-4/h7-15H,1-6H3 |
| InChIKey | CZVUIQIYQXYJMR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 138.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |