About 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine
6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine (PubChem CID 79306867) has the molecular formula C11H10BrN5S
and a molecular weight of 324.21 g/mol. Its IUPAC name is 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 79306867 |
| Molecular Formula | C11H10BrN5S |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ncc(Cn2c(N)nc3cc(Br)cnc32)s1 |
| InChI | InChI=1S/C11H10BrN5S/c1-6-14-4-8(18-6)5-17-10-9(16-11(17)13)2-7(12)3-15-10/h2-4H,5H2,1H3,(H2,13,16) |
| InChIKey | ZLPHWKZEKVGUBF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine (CID 79306867) is 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine is Cc1ncc(Cn2c(N)nc3cc(Br)cnc32)s1.
What is the InChIKey of 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
The InChIKey is ZLPHWKZEKVGUBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN5S/c1-6-14-4-8(18-6)5-17-10-9(16-11(17)13)2-7(12)3-15-10/h2-4H,5H2,1H3,(H2,13,16).
What are the key properties of 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine has a molecular weight of 324.21 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[(2-methyl-1,3-thiazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 79306867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).