C11H15BrN4S — CID 113487873
6-bromo-3-(4-methylsulfanylbutyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 113487873) has the molecular formula C11H15BrN4S and a molecular weight of 315.24 g/mol. Its IUPAC name is 6-bromo-3-(4-methylsulfanylbutyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 6-bromo-3-(4-methylsulfanylbutyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 113487873 |
| Molecular Formula | C11H15BrN4S |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 6-bromo-3-(4-methylsulfanylbutyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | CSCCCCn1c(N)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C11H15BrN4S/c1-17-5-3-2-4-16-10-9(15-11(16)13)6-8(12)7-14-10/h6-7H,2-5H2,1H3,(H2,13,15) |
| InChIKey | GAKSUJIKPJXPPZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|