C23H23ClN2O — CID 67160044
3-(2-benzyl-3,4-dihydro-1H-isoquinolin-6-yl)benzamide;hydrochloride (PubChem CID 67160044) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is 3-(2-benzyl-3,4-dihydro-1H-isoquinolin-6-yl)benzamide;hydrochloride.
| Compound Name | 3-(2-benzyl-3,4-dihydro-1H-isoquinolin-6-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 67160044 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-(2-benzyl-3,4-dihydro-1H-isoquinolin-6-yl)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(-c2ccc3c(c2)CCN(Cc2ccccc2)C3)c1 |
| InChI | InChI=1S/C23H22N2O.ClH/c24-23(26)21-8-4-7-18(14-21)19-9-10-22-16-25(12-11-20(22)13-19)15-17-5-2-1-3-6-17;/h1-10,13-14H,11-12,15-16H2,(H2,24,26);1H |
| InChIKey | PKZGWALAEPUDNP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |