6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid

C16H16N2O2 — CID 46839896

IUPAC6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid
SMILESO=C(O)c1ccc2c(n1)CCN(Cc1ccccc1)C2
InChIInChI=1S/C16H16N2O2/c19-16(20)15-7-6-13-11-18(9-8-14(13)17-15)10-12-4-2-1-3-5-12/h1-7H,8-11H2,(H,19,20)
InChIKeyNCPNSYDXGVRYAJ-UHFFFAOYSA-N
MW268.32 g/mol
LogP2.34
Rot. Bonds3

About 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid

6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid (PubChem CID 46839896) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid
PubChem CID46839896
Molecular FormulaC16H16N2O2
Molecular Weight268.32 g/mol
Exact Mass268.12
IUPAC Name6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid
SMILESO=C(O)c1ccc2c(n1)CCN(Cc1ccccc1)C2
InChIInChI=1S/C16H16N2O2/c19-16(20)15-7-6-13-11-18(9-8-14(13)17-15)10-12-4-2-1-3-5-12/h1-7H,8-11H2,(H,19,20)
InChIKeyNCPNSYDXGVRYAJ-UHFFFAOYSA-N
XLogP2.34
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.32
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid?
The IUPAC name of 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid (CID 46839896) is 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid.
What is the SMILES notation for 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid?
The canonical SMILES for 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid is O=C(O)c1ccc2c(n1)CCN(Cc1ccccc1)C2.
What is the InChIKey of 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid?
The InChIKey is NCPNSYDXGVRYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c19-16(20)15-7-6-13-11-18(9-8-14(13)17-15)10-12-4-2-1-3-5-12/h1-7H,8-11H2,(H,19,20).
What are the key properties of 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid?
6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid has a molecular weight of 268.32 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylic acid is sourced from PubChem (CID 46839896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).