C20H17F3N2NaO — CID 172756163
CID 172756163 (PubChem CID 172756163) has the molecular formula C20H17F3N2NaO and a molecular weight of 381.35 g/mol.
| Compound Name | CID 172756163 |
|---|---|
| PubChem CID | 172756163 |
| Molecular Formula | C20H17F3N2NaO |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc(-c2ccc3c(n2)CCN(Cc2ccccc2)C3)o1.[Na] |
| InChI | InChI=1S/C20H17F3N2O.Na/c21-20(22,23)19-9-8-18(26-19)17-7-6-15-13-25(11-10-16(15)24-17)12-14-4-2-1-3-5-14;/h1-9H,10-13H2; |
| InChIKey | LAXRFHWYFJTSBJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |