C17H19N3O3S — CID 174298028
6-carbamoyl-2-[[3-(sulfinoamino)phenyl]methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 174298028) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 6-carbamoyl-2-[[3-(sulfinoamino)phenyl]methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-carbamoyl-2-[[3-(sulfinoamino)phenyl]methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 174298028 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 6-carbamoyl-2-[[3-(sulfinoamino)phenyl]methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | NC(=O)c1ccc2c(c1)CCN(Cc1cccc(NS(=O)O)c1)C2 |
| InChI | InChI=1S/C17H19N3O3S/c18-17(21)14-4-5-15-11-20(7-6-13(15)9-14)10-12-2-1-3-16(8-12)19-24(22)23/h1-5,8-9,19H,6-7,10-11H2,(H2,18,21)(H,22,23) |
| InChIKey | SBMPLOJYVWKUQI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|