About 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide
3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide (PubChem CID 144656545) has the molecular formula C24H23FN2O
and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide.
Molecular Properties
| Compound Name | 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide |
| PubChem CID | 144656545 |
| Molecular Formula | C24H23FN2O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(CN3CCc4cc(F)ccc4C3)c2)cc1 |
| InChI | InChI=1S/C24H23FN2O/c1-17-5-9-23(10-6-17)26-24(28)20-4-2-3-18(13-20)15-27-12-11-19-14-22(25)8-7-21(19)16-27/h2-10,13-14H,11-12,15-16H2,1H3,(H,26,28) |
| InChIKey | VXUIQRGLPDCXJR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide?
The IUPAC name of 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide (CID 144656545) is 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide.
What is the SMILES notation for 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide?
The canonical SMILES for 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide is Cc1ccc(NC(=O)c2cccc(CN3CCc4cc(F)ccc4C3)c2)cc1.
What is the InChIKey of 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide?
The InChIKey is VXUIQRGLPDCXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23FN2O/c1-17-5-9-23(10-6-17)26-24(28)20-4-2-3-18(13-20)15-27-12-11-19-14-22(25)8-7-21(19)16-27/h2-10,13-14H,11-12,15-16H2,1H3,(H,26,28).
What are the key properties of 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide?
3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide has a molecular weight of 374.46 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-methylphenyl)benzamide is sourced from PubChem (CID 144656545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).