C15H15BrClN — CID 57431190
2-benzyl-4-bromo-1,3-dihydroisoindole;hydrochloride (PubChem CID 57431190) has the molecular formula C15H15BrClN and a molecular weight of 324.65 g/mol. Its IUPAC name is 2-benzyl-4-bromo-1,3-dihydroisoindole;hydrochloride.
| Compound Name | 2-benzyl-4-bromo-1,3-dihydroisoindole;hydrochloride |
|---|---|
| PubChem CID | 57431190 |
| Molecular Formula | C15H15BrClN |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-benzyl-4-bromo-1,3-dihydroisoindole;hydrochloride |
| SMILES | Brc1cccc2c1CN(Cc1ccccc1)C2.Cl |
| InChI | InChI=1S/C15H14BrN.ClH/c16-15-8-4-7-13-10-17(11-14(13)15)9-12-5-2-1-3-6-12;/h1-8H,9-11H2;1H |
| InChIKey | MCPPKORUMVJNJP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |