C15H14F2N2 — CID 105404497
2-[(3,5-difluorophenyl)methyl]-1,3-dihydroisoindol-4-amine (PubChem CID 105404497) has the molecular formula C15H14F2N2 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 105404497 |
| Molecular Formula | C15H14F2N2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-1,3-dihydroisoindol-4-amine |
| SMILES | Nc1cccc2c1CN(Cc1cc(F)cc(F)c1)C2 |
| InChI | InChI=1S/C15H14F2N2/c16-12-4-10(5-13(17)6-12)7-19-8-11-2-1-3-15(18)14(11)9-19/h1-6H,7-9,18H2 |
| InChIKey | CKEBLFRTXFOWSN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|