C19H24N2 — CID 43370254
2-[(4-tert-butylphenyl)methyl]-1,3-dihydroisoindol-4-amine (PubChem CID 43370254) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 43370254 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-1,3-dihydroisoindol-4-amine |
| SMILES | CC(C)(C)c1ccc(CN2Cc3cccc(N)c3C2)cc1 |
| InChI | InChI=1S/C19H24N2/c1-19(2,3)16-9-7-14(8-10-16)11-21-12-15-5-4-6-18(20)17(15)13-21/h4-10H,11-13,20H2,1-3H3 |
| InChIKey | YBUYXZUNYROJKB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|