C20H31N3O3S — CID 3719162
ethyl 6-[[4-(2-methylsulfanylphenyl)piperazine-1-carbonyl]amino]hexanoate (PubChem CID 3719162) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is ethyl 6-[[4-(2-methylsulfanylphenyl)piperazine-1-carbonyl]amino]hexanoate.
| Compound Name | ethyl 6-[[4-(2-methylsulfanylphenyl)piperazine-1-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 3719162 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethyl 6-[[4-(2-methylsulfanylphenyl)piperazine-1-carbonyl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)N1CCN(c2ccccc2SC)CC1 |
| InChI | InChI=1S/C20H31N3O3S/c1-3-26-19(24)11-5-4-8-12-21-20(25)23-15-13-22(14-16-23)17-9-6-7-10-18(17)27-2/h6-7,9-10H,3-5,8,11-16H2,1-2H3,(H,21,25) |
| InChIKey | FZRCGUNCYLKAKZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|