C22H30N2O3 — CID 171389133
1-[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxypropan-1-one (PubChem CID 171389133) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxypropan-1-one.
| Compound Name | 1-[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 171389133 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxypropan-1-one |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(C(=O)CCO)C[C@H]2CN1C(=O)C1CCCC1 |
| InChI | InChI=1S/C22H30N2O3/c1-15-6-2-5-9-18(15)21-19-14-23(20(26)10-11-25)12-17(19)13-24(21)22(27)16-7-3-4-8-16/h2,5-6,9,16-17,19,21,25H,3-4,7-8,10-14H2,1H3/t17-,19-,21+/m0/s1 |
| InChIKey | AIOHKZVFCFSXIY-HFSMHLIXSA-N |
| XLogP | 2.53 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |