C22H27N5O2 — CID 170502997
1-[(3aR,4S,6aS)-5-(cyclobutanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(1,2,4-triazol-4-yl)propan-1-one (PubChem CID 170502997) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-5-(cyclobutanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(1,2,4-triazol-4-yl)propan-1-one.
| Compound Name | 1-[(3aR,4S,6aS)-5-(cyclobutanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(1,2,4-triazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 170502997 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-[(3aR,4S,6aS)-5-(cyclobutanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(1,2,4-triazol-4-yl)propan-1-one |
| SMILES | O=C(CCn1cnnc1)N1C[C@H]2CN(C(=O)C3CCC3)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C22H27N5O2/c28-20(9-10-25-14-23-24-15-25)26-11-18-12-27(22(29)17-7-4-8-17)21(19(18)13-26)16-5-2-1-3-6-16/h1-3,5-6,14-15,17-19,21H,4,7-13H2/t18-,19-,21+/m0/s1 |
| InChIKey | KBDPWAVJGWGZFS-IRFCIJBXSA-N |
| XLogP | 2.13 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |