C24H28N4O3 — CID 170512103
[(3aR,4R,6aS)-4-(4-methoxyphenyl)-2-(pyridazine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone (PubChem CID 170512103) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-(4-methoxyphenyl)-2-(pyridazine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone.
| Compound Name | [(3aR,4R,6aS)-4-(4-methoxyphenyl)-2-(pyridazine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 170512103 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [(3aR,4R,6aS)-4-(4-methoxyphenyl)-2-(pyridazine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone |
| SMILES | COc1ccc([C@H]2[C@H]3CN(C(=O)c4ccnnc4)C[C@H]3CN2C(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-31-20-8-6-16(7-9-20)22-21-15-27(23(29)18-10-11-25-26-12-18)13-19(21)14-28(22)24(30)17-4-2-3-5-17/h6-12,17,19,21-22H,2-5,13-15H2,1H3/t19-,21-,22-/m0/s1 |
| InChIKey | JGWHRABKMSWZAF-BVSLBCMMSA-N |
| XLogP | 2.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |