C25H29N3O3 — CID 171914485
2-[(3aR,4R,6aS)-5-(2,3-dihydro-1H-indene-2-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide (PubChem CID 171914485) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[(3aR,4R,6aS)-5-(2,3-dihydro-1H-indene-2-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide.
| Compound Name | 2-[(3aR,4R,6aS)-5-(2,3-dihydro-1H-indene-2-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide |
|---|---|
| PubChem CID | 171914485 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[(3aR,4R,6aS)-5-(2,3-dihydro-1H-indene-2-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide |
| SMILES | COc1ccc([C@H]2[C@H]3CN(CC(N)=O)C[C@H]3CN2C(=O)C2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-31-21-8-6-16(7-9-21)24-22-14-27(15-23(26)29)12-20(22)13-28(24)25(30)19-10-17-4-2-3-5-18(17)11-19/h2-9,19-20,22,24H,10-15H2,1H3,(H2,26,29)/t20-,22-,24-/m0/s1 |
| InChIKey | NSLFBPLEBDEZQR-SSPYTLHUSA-N |
| XLogP | 2.03 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |