C23H29Cl2N3O3 — CID 171330239
3-[2-[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethyl]-1,3-benzoxazol-2-one;dihydrochloride (PubChem CID 171330239) has the molecular formula C23H29Cl2N3O3 and a molecular weight of 466.41 g/mol. Its IUPAC name is 3-[2-[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethyl]-1,3-benzoxazol-2-one;dihydrochloride.
| Compound Name | 3-[2-[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethyl]-1,3-benzoxazol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 171330239 |
| Molecular Formula | C23H29Cl2N3O3 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 3-[2-[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethyl]-1,3-benzoxazol-2-one;dihydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(CCn4c(=O)oc5ccccc54)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C23H27N3O3.2ClH/c1-24-13-17-14-25(11-12-26-20-5-3-4-6-21(20)29-23(26)27)15-19(17)22(24)16-7-9-18(28-2)10-8-16;;/h3-10,17,19,22H,11-15H2,1-2H3;2*1H/t17-,19+,22+;;/m0../s1 |
| InChIKey | LQBVRZCGWHGEMI-ZJZMBGPLSA-N |
| XLogP | 3.68 |
| TPSA | 50.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |