C20H29ClN4O2 — CID 171709977
2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-tert-butyl-1,3,4-oxadiazole;hydrochloride (PubChem CID 171709977) has the molecular formula C20H29ClN4O2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-tert-butyl-1,3,4-oxadiazole;hydrochloride.
| Compound Name | 2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-tert-butyl-1,3,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 171709977 |
| Molecular Formula | C20H29ClN4O2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-tert-butyl-1,3,4-oxadiazole;hydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(c4nnc(C(C)(C)C)o4)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C20H28N4O2.ClH/c1-20(2,3)18-21-22-19(26-18)24-11-14-10-23(4)17(16(14)12-24)13-6-8-15(25-5)9-7-13;/h6-9,14,16-17H,10-12H2,1-5H3;1H/t14-,16+,17+;/m0./s1 |
| InChIKey | YFOPOZMOCWDQFY-DYWKTHLTSA-N |
| XLogP | 3.54 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |