C22H27ClN6O — CID 171709735
(3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 171709735) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is (3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 171709735 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(Cc4ccc(-c5nn[nH]n5)cc4)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C22H26N6O.ClH/c1-27-12-18-13-28(11-15-3-5-17(6-4-15)22-23-25-26-24-22)14-20(18)21(27)16-7-9-19(29-2)10-8-16;/h3-10,18,20-21H,11-14H2,1-2H3,(H,23,24,25,26);1H/t18-,20+,21-;/m0./s1 |
| InChIKey | HHJZKQAHHRFNDB-JUFSGVNBSA-N |
| XLogP | 3.03 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |