C23H28Cl2N4O2 — CID 171329567
2-[[(3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]pyrido[1,2-a]pyrimidin-4-one;dihydrochloride (PubChem CID 171329567) has the molecular formula C23H28Cl2N4O2 and a molecular weight of 463.41 g/mol. Its IUPAC name is 2-[[(3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]pyrido[1,2-a]pyrimidin-4-one;dihydrochloride.
| Compound Name | 2-[[(3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]pyrido[1,2-a]pyrimidin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 171329567 |
| Molecular Formula | C23H28Cl2N4O2 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[[(3R,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]pyrido[1,2-a]pyrimidin-4-one;dihydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(Cc4cc(=O)n5ccccc5n4)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C23H26N4O2.2ClH/c1-25-12-17-13-26(14-18-11-22(28)27-10-4-3-5-21(27)24-18)15-20(17)23(25)16-6-8-19(29-2)9-7-16;;/h3-11,17,20,23H,12-15H2,1-2H3;2*1H/t17-,20+,23-;;/m0../s1 |
| InChIKey | OZCYLCPGZZRUAG-VZVVOLIGSA-N |
| XLogP | 3.28 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |