C19H19N3O2 — CID 92853203
2-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 92853203) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 92853203 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CN2CCO[C@@H](c3ccccc3)C2)nc2ccccn12 |
| InChI | InChI=1S/C19H19N3O2/c23-19-12-16(20-18-8-4-5-9-22(18)19)13-21-10-11-24-17(14-21)15-6-2-1-3-7-15/h1-9,12,17H,10-11,13-14H2/t17-/m1/s1 |
| InChIKey | YRJRTKOKVTWQNE-QGZVFWFLSA-N |
| XLogP | 2.27 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |